BD7861531
1-tert-Butyl-4-chlorobenzene , 97% , 3972-56-3
CAS NO.:3972-56-3
Empirical Formula: C10H13Cl
Molecular Weight: 168.66
MDL number: MFCD00236378
EINECS: 223-598-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB28.80 | In Stock |
|
| 100g | RMB75.20 | In Stock |
|
| 500g | RMB316.80 | In Stock |
|
| 1000g | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36°C (estimate) |
| Boiling point: | 216 °C |
| Density | 1.01 |
| refractive index | 1.5123 |
| Flash point: | 23 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | InChI=1S/C10H13Cl/c1-10(2,3)8-4-6-9(11)7-5-8/h4-7H,1-3H3 |
| InChIKey | XRTANKYQJQXSFP-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 3972-56-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Chloro-4-(1,1-dimethylethyl)benzene(3972-56-3) |
| EPA Substance Registry System | 4-tert-Butylchlorobenzene (3972-56-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 2903998090 |




