BD7863831
(1R,2S)-2-Aminocyclopentanol hydrochloride , 95% , 137254-03-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB58.40 | In Stock |
|
| 250mg | RMB106.40 | In Stock |
|
| 1g | RMB328.80 | In Stock |
|
| 5g | RMB1319.20 | In Stock |
|
| 25g | RMB5402.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Appearance | White to light brown Solid |
| optical activity | -22.0371°(C=0.9948g/100ml ETOH) |
| InChI | InChI=1/C5H11NO.ClH/c6-4-2-1-3-5(4)7;/h4-5,7H,1-3,6H2;1H/t4-,5+;/s3 |
| InChIKey | ZFSXKSSWYSZPGQ-UYXJWNHNSA-N |
| SMILES | N[C@H]1CCC[C@H]1O.Cl |&1:1,5,r| |
Description and Uses
(1R,2S)-cis-2-Aminocyclopentanol hydrochloride is an amino alcohol derivative and is mainly used in pharmaceutical synthesis.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-41 |
| Safety Statements | 29-39 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2922190090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 |





![(1R,3R,5R)-2-(tert-Butoxycarbonyl)-2-azabicyclo[3.1.0]hexane-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/1148048-39-8.gif)

![(1<I>S</I>)<WBR>-<WBR>(+)<WBR>-<WBR>2-<WBR>Azabicyclo[2.2.1]<WBR>hept-<WBR>5-<WBR>en-<WBR>3-<WBR>one](https://img.chemicalbook.com/CAS/GIF/130931-83-8.gif)