BD7875831
4,4-Difluorocyclohexanecarbaldehyde , 95% , 265108-36-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB324.00 | In Stock |
|
| 250mg | RMB486.40 | In Stock |
|
| 1g | RMB1100.00 | In Stock |
|
| 5g | RMB3532.80 | In Stock |
|
| 25g | RMB10615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 165.0±40.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H10F2O/c8-7(9)3-1-6(5-10)2-4-7/h5-6H,1-4H2 |
| InChIKey | DNSDOTKSZMHDOR-UHFFFAOYSA-N |
| SMILES | C1(C=O)CCC(F)(F)CC1 |
Description and Uses
4,4-Difluorocyclohexanecarbaldehyde is used in the preparation of heteroaryl acid derivative and methods for treating oxalate-related diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P332+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2913000090 |
