![N-[(S)-1-Carbethoxy-1-butyl]-L-alanine](https://img.chemicalbook.com/CAS/GIF/82834-12-6.gif)
BD7887631
N-[(S)-1-Carbethoxy-1-butyl]-L-alanine , 95% , 82834-12-6
CAS NO.：82834-12-6
Empirical Formula: C10H19NO4
Molecular Weight: 217.26
MDL number: MFCD07782126
EINECS: 617-393-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB116.00 | In Stock |
|
| 25g | RMB345.60 | In Stock |
|
| 100g | RMB1040.00 | In Stock |
|
| 500g | RMB3640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-150°C |
| Boiling point: | 324.1±27.0 °C(Predicted) |
| Density | 1.079±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO, Methanol |
| form | Solid |
| pka | 2.15±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C10H19NO4/c1-4-6-8(10(14)15-5-2)11-7(3)9(12)13/h7-8,11H,4-6H2,1-3H3,(H,12,13)/t7-,8-/m0/s1 |
| InChIKey | AUVAVXHAOCLQBF-YUMQZZPRSA-N |
| SMILES | C(OCC)(=O)[C@H](CCC)N[C@H](C(O)=O)C |
| LogP | 0.3 at 25℃ and pH6 |
| CAS DataBase Reference | 82834-12-6(CAS DataBase Reference) |
Description and Uses
Perindopril intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315-H412 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P273-P501 |
