BD7889731
(S)-1-Boc-3-(Aminomethyl)pyrrolidine , 97% , 199175-10-5
Synonym(s):
(S)-3-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine;tert-Butyl (S)-3-(aminomethyl)-1-pyrrolidinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB168.80 | In Stock |
|
| 1g | RMB298.40 | In Stock |
|
| 5g | RMB996.00 | In Stock |
|
| 10g | RMB1660.00 | In Stock |
|
| 25g | RMB3320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 280.3±13.0 °C(Predicted) |
| Density | 1.044±0.06 g/cm3(Predicted) |
| refractive index | 1.4780 |
| storage temp. | 2-8°C |
| pka | 10.12±0.29(Predicted) |
| form | Liquid |
| color | Colorless to yellow |
| optical activity | Consistent with structure |
| Sensitive | Air Sensitive |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-7,11H2,1-3H3/t8-/m0/s1 |
| InChIKey | OGCCBDIYOAFOGK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CN)C1 |
| CAS DataBase Reference | 199175-10-5(CAS DataBase Reference) |
Description and Uses
(S)-1-Boc-3-(Aminomethyl)pyrrolidine is a useful research chemical for organic synthesis and other chemical processes.It is used in preparation of isoquinoline derivatives as progranulin modulators useful in treatment of progranulin- associated disorders.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
