BD7900031
Diisopropyl carbonate , 98% , 6482-34-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB26.40 | In Stock |
|
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB153.60 | In Stock |
|
| 5g | RMB635.20 | In Stock |
|
| 10g | RMB1169.60 | In Stock |
|
| 25g | RMB2492.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 147 °C |
| Density | 0.945 |
| refractive index | 1.3932 |
| Flash point: | 53 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C7H14O3/c1-5(2)9-7(8)10-6(3)4/h5-6H,1-4H3 |
| InChIKey | JMPVESVJOFYWTB-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)OC(C)C |
Description and Uses
Diisopropyl Carbonate is used in the synthesis of Huperizine A (H826000) a reversible alkaloid inhibitor of AChE which crosses the blood-brain barrier. A potential therapeutic agent for Alzheimer’s disease. It reduces cell death induced by glutamate in primary cultures derived from forebrain, hippocampus, cortex and cerebellum of embryonic rat brain.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H411-H372 |
| Precautionary statements | P261-P280-P273-P305+P351+P338 |
