BD7906231
4-Chloronaphthalen-1-ol , 97% , 604-44-4
Synonym(s):
4-chloronaphthalen-1-ol;4-CN
CAS NO.:604-44-4
Empirical Formula: C10H7ClO
Molecular Weight: 178.62
MDL number: MFCD00003974
EINECS: 210-068-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB61.60 | In Stock |
|
| 5g | RMB169.60 | In Stock |
|
| 10g | RMB307.20 | In Stock |
|
| 25g | RMB647.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121 °C(lit.) |
| Boiling point: | 254.41°C (rough estimate) |
| Density | density |
| refractive index | 1.4575 (estimate) |
| Flash point: | 73 °C |
| storage temp. | -20°C |
| solubility | methanol: 50 mg/mL, clear, colorless to very faintly yellow |
| pka | 9.11±0.40(Predicted) |
| form | tablets (~32 mg each) |
| color | Off-white to gray to light brown |
| BRN | 509750 |
| InChI | InChI=1S/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| InChIKey | LVSPDZAGCBEQAV-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=C(Cl)C=C1 |
| CAS DataBase Reference | 604-44-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenol, 4-chloro- (604-44-4) |
Description and Uses
Suitable for visualizing protein-peroxidase conjugates in western blotting.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-39/23/24/25-20/21/22 |
| Safety Statements | 26-36-45-36/37 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| F | 8-9-23 |
| TSCA | TSCA listed |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |







