BD7910731
Quinoline-8-carboxylic acid , 98% , 86-59-9
CAS NO.:86-59-9
Empirical Formula: C10H7NO2
Molecular Weight: 173.17
MDL number: MFCD00047619
EINECS: 632-930-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.80 | In Stock |
|
| 1g | RMB98.40 | In Stock |
|
| 5g | RMB341.60 | In Stock |
|
| 10g | RMB584.80 | In Stock |
|
| 25g | RMB1408.00 | In Stock |
|
| 100g | RMB4252.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C (lit.) |
| Boiling point: | 303.81°C (rough estimate) |
| Density | 1.2427 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 1.82(at 25℃) |
| color | Light brown |
| Water Solubility | Insoluble |
| Merck | 14,8070 |
| BRN | 19176 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6H,(H,12,13) |
| InChIKey | QRDZFPUVLYEQTA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2C(O)=O)C=CC=1 |
| CAS DataBase Reference | 86-59-9(CAS DataBase Reference) |
Description and Uses
8-Quinolinecarboxylic acid may be used in the synthesis of:
- novel oxorhenium(V) complexes incorporating quinoline and isoquinoline carboxylic acid derivatives
- chiral 1,2,3,4-tetrahydroquinolinyl-oxazoline compounds, used as ligands for Ru-catalyzed asymmetric transfer hydrogenation of ketones
- chiral quinolinyl-oxazoline compounds, used as ligands for Cu(II) catalyzed asymmetric cyclopropanation
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






