BD7937331
4-Methoxyindole-2-carboxylic acid , 98% , 103260-65-7
CAS NO.:103260-65-7
Empirical Formula: C10H9NO3
Molecular Weight: 191.18
MDL number: MFCD02664458
EINECS: 607-884-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB96.00 | In Stock |
|
| 5g | RMB412.00 | In Stock |
|
| 10g | RMB800.80 | In Stock |
|
| 25g | RMB1743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-235 °C |
| Boiling point: | 447.6±25.0 °C(Predicted) |
| Density | 1.381±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 4.52±0.30(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C10H9NO3/c1-14-9-4-2-3-7-6(9)5-8(11-7)10(12)13/h2-5,11H,1H3,(H,12,13) |
| InChIKey | ZZAVIQXQBBOHBB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(OC)=CC=C2)C=C1C(O)=O |
| CAS DataBase Reference | 103260-65-7(CAS DataBase Reference) |
Description and Uses
4-Methoxy-1H-indole-2-carboxylic acid can be used as a precursor to prepare 4-methoxy-1H-indole-2-carboxamide via treatment with thionyl chloride in dry tetrahydrofuran, followed by reaction with ammonia[6].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |







