BD7945631
Ethyl 7-nitro-1H-indole-2-carboxylate , 97% , 6960-46-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB71.20 | In Stock |
|
| 5g | RMB351.20 | In Stock |
|
| 10g | RMB666.40 | In Stock |
|
| 25g | RMB1529.60 | In Stock |
|
| 100g | RMB6012.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-96 °C |
| Boiling point: | 376.52°C (rough estimate) |
| Density | 1.3240 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 11.98±0.30(Predicted) |
| Appearance | Light yellow to yellow Solid |
| Water Solubility | Negligible |
| InChI | InChI=1S/C11H10N2O4/c1-2-17-11(14)8-6-7-4-3-5-9(13(15)16)10(7)12-8/h3-6,12H,2H2,1H3 |
| InChIKey | GTZAIVBXGPLYGD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C=C1C(OCC)=O |
| CAS DataBase Reference | 6960-46-9(CAS DataBase Reference) |
Description and Uses
Ethyl 7-Nitroindole-2-carboxylate is used to prepare aryl(indolyl)oxadiazoles via Fischer indole synthesis of pyruvate nitrophenylhydrazones. It is also used to synthesize p38 Inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
