BD7960331
Fmoc-D-Orn(Boc)-OH , 96% , 118476-89-4
Synonym(s):
Fmoc-D-Orn(Boc)-OH;N-α-Fmoc-N-δ-t.-Boc-D-ornithine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB209.60 | In Stock |
|
| 10g | RMB404.80 | In Stock |
|
| 25g | RMB984.00 | In Stock |
|
| 100g | RMB3564.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 679.0±55.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.85±0.21(Predicted) |
| form | Powder |
| color | Yellow |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | JOOIZTMAHNLNHE-OAQYLSRUSA-N |
| SMILES | N([C@H](CCCNC(=O)OC(C)(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| CAS DataBase Reference | 118476-89-4 |
Description and Uses
Fmoc-D-Orn(Boc)-OH is a reagent used for the synthesis of bisquinoline analogs with antileishmanial and antimicrobial activities against a panel of pathogenic bacteria and fungi.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







