(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoic acid , 98% , 197632-76-1
Synonym(s):
Fmoc-N-Me-Lys(Boc)-OH;N-α-Fmoc-N-α-methyl-N-ε-t.-Boc-L-lysine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB205.60 | In Stock |
|
| 1g | RMB528.00 | In Stock |
|
| 5g | RMB1868.80 | In Stock |
|
| 10g | RMB3200.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 189-194°C (decomposition) |
| Boiling point: | 665.4±55.0 °C(Predicted) |
| Density | 1.200 |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.90±0.21(Predicted) |
| color | White to off-white |
| optical activity | [α]22/D -14.0°, c = 1% in chloroform |
| Major Application | peptide synthesis |
| InChIKey | JMBKBGOKNZZJQA-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(OC(C)(C)C)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 197632-76-1 |
Description and Uses
Fmoc-N-Me-Lys(Boc)-OH is a peptide that mimics the structure of the natural substrate of serine protease. It has been shown to be stable in extracellular fluids and resistant to proteolytic degradation. The systematic sequence was designed to maximize the chance of binding to the active site of serine proteases while minimizing binding to other proteases. The maximal modifications were made on the amino acid side chains, which are most likely to interact with other proteins or with cell surfaces.
N2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N6-(tert-butoxycarbonyl)-N2-methyl-L-lysine is a lysine derivative[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |





