BD7970931
(4-(Morpholine-4-carbonyl)phenyl)boronic acid , 98% , 389621-84-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB137.60 | In Stock |
|
| 1g | RMB349.60 | In Stock |
|
| 5g | RMB1213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-132°C |
| Boiling point: | 481.6±55.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 8.29±0.16(Predicted) |
| form | solid |
| color | white |
| InChI | 1S/C11H14BNO4/c14-11(13-5-7-17-8-6-13)9-1-3-10(4-2-9)12(15)16/h1-4,15-16H,5-8H2 |
| InChIKey | KMNLIQJXZPBCDU-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(cc1)C(=O)N2CCOCC2 |
| CAS DataBase Reference | 389621-84-5(CAS DataBase Reference) |
Description and Uses
4-(Morpholinocarbonyl)benzeneboronic Acid, is a building block used for the synthesis of various pharmaceutical and biologically active compounds. It is used for the synthesis of a series of arylphthalazine derivatives as potent, and orally bioavailable inhibitors of VEGFR-2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |







