BD7972331
2,2-Dimethoxyacetaldehyde(60 wt. % in H2O) , 60wt.%inH2O , 51673-84-8
Synonym(s):
Glyoxal 1-(dimethyl acetal);Glyoxal dimethyl acetal
CAS NO.：51673-84-8
Empirical Formula: C4H8O3
Molecular Weight: 104.1
MDL number: MFCD00134410
EINECS: 421-890-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB45.60 | In Stock |
|
| 25g | RMB88.80 | In Stock |
|
| 100g | RMB324.80 | In Stock |
|
| 500g | RMB1516.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C |
| Density | 1.15 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear colourless |
| Water Solubility | Fully miscible in water. |
| BRN | 1850744 |
| InChI | InChI=1S/C4H8O3/c1-6-4(3-5)7-2/h3-4H,1-2H3 |
| InChIKey | OGFKTAMJLKHRAZ-UHFFFAOYSA-N |
| SMILES | C(=O)C(OC)OC |
| EPA Substance Registry System | Acetaldehyde, dimethoxy- (51673-84-8) |
Description and Uses
Glyoxal dimethyl acetal is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuffs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 43-38-11 |
| Safety Statements | 24-37-36/37-16 |
| RIDADR | UN 2398 3/PG 2 |
| WGK Germany | - |
| TSCA | TSCA listed |
| HazardClass | CBL |
| HS Code | 2912490090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Sens. 1 |
| Excepted Quantities | Non-Hazardous |
