BD7984031
H-Tyr(tBu)-OMe.HCl , 95% , 51482-39-4
CAS NO.：51482-39-4
Empirical Formula: C14H22ClNO3
Molecular Weight: 287.78
MDL number: MFCD00153466
EINECS: 257-234-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB191.20 | In Stock |
|
| 10g | RMB337.60 | In Stock |
|
| 25g | RMB680.00 | In Stock |
|
| 100g | RMB2196.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,2-8°C |
| form | flakes |
| Appearance | White to off-white Solid |
| BRN | 7696272 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H21NO3.ClH/c1-14(2,3)18-11-7-5-10(6-8-11)9-12(15)13(16)17-4;/h5-8,12H,9,15H2,1-4H3;1H/t12-;/m0./s1 |
| InChIKey | PAFVAMWJVIIMQK-YDALLXLXSA-N |
| SMILES | Cl.COC(=O)[C@@H](N)Cc1ccc(OC(C)(C)C)cc1 |
| CAS DataBase Reference | 51482-39-4(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H319-H334 |
| Precautionary statements | P261-P305+P351+P338-P342+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
