BD7987531
tert-Butyl 2-cyanopiperidine-1-carboxylate , 97% , 153749-89-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB124.80 | In Stock |
|
| 10g | RMB235.20 | In Stock |
|
| 25g | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-67℃ |
| Boiling point: | 325.3±35.0 °C(Predicted) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -4.85±0.40(Predicted) |
| form | Powder |
| color | White to pale brown |
| InChI | InChI=1S/C11H18N2O2/c1-11(2,3)15-10(14)13-7-5-4-6-9(13)8-12/h9H,4-7H2,1-3H3 |
| InChIKey | LKAJZBMOVZIKHA-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCCC1C#N |
| CAS DataBase Reference | 153749-89-4(CAS DataBase Reference) |
Description and Uses
Tert-Butyl 2-cyanopiperidine-1-carboxylate is an enantioselective organometallic compound. It is a nitrile that reacts with electrophiles such as Grignard reagents and cyano to form an anion. This compound has two chiral centers, each of which can assume either the R or S configuration. The enantiomeric purity of tert-butyl 2-cyanopiperidine-1-carboxylate is greater than 99%. This compound has a low melting point and a half life of about 10 h in water, which makes it stable for use in organic synthesis. It is commonly used in science as a chiral auxiliary in asymmetric synthesis and as a catalyst for the conversion of epoxides to alcohols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 37 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |





