BD7997231
3-Phenyl-4H-chromen-4-one , 40% , 574-12-9
CAS NO.:574-12-9
Empirical Formula: C15H10O2
Molecular Weight: 222.24
MDL number: MFCD00100851
EINECS: 611-522-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB36.80 | In Stock |
|
| 100g | RMB108.80 | In Stock |
|
| 500g | RMB372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148° |
| Boiling point: | 323.41°C (rough estimate) |
| Density | 1.1404 (rough estimate) |
| refractive index | 1.6600 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| InChI | InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H |
| InChIKey | GOMNOOKGLZYEJT-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC=C2C(=O)C=1C1=CC=CC=C1 |
| LogP | 3.013 (est) |
| CAS DataBase Reference | 574-12-9(CAS DataBase Reference) |
Description and Uses
Isoflavones possess antioxidant properties and antipromotional effects.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |





