BD7998031
tert-Butyl 4-(2-hydroxyethyl)piperazine-1-carboxylate , 97% , 77279-24-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB22.40 | In Stock |
|
| 5g | RMB78.40 | In Stock |
|
| 10g | RMB152.00 | In Stock |
|
| 25g | RMB352.80 | In Stock |
|
| 100g | RMB1244.80 | In Stock |
|
| 500g | RMB4482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C |
| Boiling point: | 114°C 0,1mm |
| Density | 1.092±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| pka | 14.96±0.10(Predicted) |
| form | Solid |
| color | White to pale brown |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)13-6-4-12(5-7-13)8-9-14/h14H,4-9H2,1-3H3 |
| InChIKey | VRXIOAYUQIITBU-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCN(CCO)CC1 |
| CAS DataBase Reference | 77279-24-4(CAS DataBase Reference) |
Description and Uses
Boc-Piperazine-OH is a PROTAC Linker in SJ46420 (HY-168635)[1].
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P273-P301+P310+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | C,N,T |
| Risk Statements | 36/37/38-50-25 |
| Safety Statements | 26-36/37/39-61-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2933599590 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







