BD8013531
4-(4-Hydroxy-4-methylpentyl)cyclohex-3-enecarbaldehyde , 97%mixtureofisomers , 31906-04-4
CAS NO.:31906-04-4
Empirical Formula: C13H22O2
Molecular Weight: 210.31
MDL number: MFCD00019423
EINECS: 250-863-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB155.20 | In Stock |
|
| 1g | RMB212.00 | In Stock |
|
| 5g | RMB612.80 | In Stock |
|
| 25g | RMB1740.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 289.85°C (rough estimate) |
| Density | 0.995 g/mL at 20 °C |
| refractive index | 1.486-1.493 |
| Flash point: | 93 °C |
| storage temp. | 2-8°C |
| solubility | Benzene (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 15.31±0.29(Predicted) |
| form | Liquid |
| color | Colourless to Pale Yellow |
| Odor | at 100.00 %. floral muguet cyclamen rhubarb woody |
| Odor Type | floral |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C13H22O2/c1-13(2,15)9-3-4-11-5-7-12(10-14)8-6-11/h5,10,12,15H,3-4,6-9H2,1-2H3 |
| InChIKey | ORMHZBNNECIKOH-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C1CCC(CCCC(C)(C)O)=CC1 |
| LogP | 2.080 |
| CAS DataBase Reference | 31906-04-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Cyclohexene-1-carboxaldehyde, 4-(4-hydroxy-4-methylpentyl)- (31906-04-4) |
Description and Uses
hydroxyisohexyl 3-cyclohexene carboxaldehyde is fragrance with a light floral scent. It may cause skin irritation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | GW2850000 |
| F | 10-23 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |





