BD8029531
Methyl 3-amino-5-methylthiophene-2-carboxylate , 97% , 76575-71-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB124.00 | In Stock |
|
| 5g | RMB398.40 | In Stock |
|
| 10g | RMB712.00 | In Stock |
|
| 25g | RMB1472.00 | In Stock |
|
| 100g | RMB4676.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-85℃ (methanol ) |
| Boiling point: | 319.2±37.0 °C(Predicted) |
| Density | 1.264±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.08±0.10(Predicted) |
| form | Solid |
| Appearance | Light yellow to light brown Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H9NO2S/c1-4-3-5(8)6(11-4)7(9)10-2/h3H,8H2,1-2H3 |
| InChIKey | FVKMOPIFLCMZMI-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)SC(C)=CC=1N |
Description and Uses
Methyl 3-amino-5-methylthiophene-2-carboxylate is employed as a intermediate for pharmaceutical and chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |







