BD8048931
(2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triol , 97% , 3396-99-4
Synonym(s):
Methyl α-D -galactoside
CAS NO.:3396-99-4
Empirical Formula: C7H14O6
Molecular Weight: 194.18
MDL number: MFCD00064085
EINECS: 222-251-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB42.40 | In Stock |
|
| 10g | RMB80.80 | In Stock |
|
| 25g | RMB150.40 | In Stock |
|
| 100g | RMB591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-117 °C(lit.) |
| Boiling point: | 250.62°C (rough estimate) |
| Density | 1.2501 (rough estimate) |
| refractive index | 176.5 ° (C=1, H2O) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Methanol (Slightly), Water (Sparingly) |
| pka | 12.92±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +169±3°, c = 1.5% in methanol |
| BRN | 81570 |
| Stability: | Hygroscopic |
| InChI | 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7+/m1/s1 |
| InChIKey | HOVAGTYPODGVJG-PZRMXXKTSA-N |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| CAS DataBase Reference | 3396-99-4(CAS DataBase Reference) |
Description and Uses
Methyl α-D-Galactopyranoside shows the most potent inhibitory activities toward the Debaryomyces hansenii UFV-1.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25-22 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




![1-D-a-Galactopyranosyl-4-O-[1-(2-octadecylthioethyl)-(b-D-galactopyranoside)]](https://img.chemicalbook.com/StructureFile/ChemBookStructure1/GIF/CB2225780.gif)

