BD8052431
Mitoxantrone , 98% , 65271-80-9
CAS NO.：65271-80-9
Empirical Formula: C22H28N4O6
Molecular Weight: 444.48
MDL number: MFCD00242942
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB110.40 | In Stock |
|
| 50mg | RMB164.80 | In Stock |
|
| 100mg | RMB233.60 | In Stock |
|
| 250mg | RMB429.60 | In Stock |
|
| 1g | RMB1330.40 | In Stock |
|
| 5g | RMB5332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-1740C |
| Boiling point: | 554.47°C (rough estimate) |
| Density | 1.3049 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly), Water (Slightly) |
| pka | pKa 5.99 (Uncertain);8.13 (Uncertain) |
| form | Solid |
| color | Dark Blue to Black |
| InChI | InChI=1S/C22H28N4O6/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32/h1-4,23-30H,5-12H2 |
| InChIKey | KKZJGLLVHKMTCM-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(NCCNCCO)=CC=C3NCCNCCO)=C(O)C=C1 |
| CAS DataBase Reference | 65271-80-9(CAS DataBase Reference) |
| IARC | 2B (Vol. 76) 2000 |
Description and Uses
A DNA intercalating drug. Inhibits DNA synthesis. Used as an anti-cancer agent
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H411 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| Hazard Codes | T,T+ |
| Risk Statements | 46-61-26/27/28 |
| Safety Statements | 53-36/37/39-45-22 |
| WGK Germany | 3 |
| RTECS | CB5748500 |
| HS Code | 2922.50.2500 |
