BD8059931
N-(3-Chloropropyl)Dibutylamine , 95% , 36421-15-5
CAS NO.:36421-15-5
Empirical Formula: C11H24ClN
Molecular Weight: 205.77
MDL number: MFCD13185966
EINECS: 253-027-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB29.60 | In Stock |
|
| 10g | RMB53.60 | In Stock |
|
| 25g | RMB92.00 | In Stock |
|
| 100g | RMB360.80 | In Stock |
|
| 500g | RMB1286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 118-130 °C(Press: 25 Torr) |
| Density | 0.899±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.39±0.50(Predicted) |
| form | liquid |
| color | Pale yellow |
| InChI | InChI=1S/C11H24ClN/c1-3-5-9-13(10-6-4-2)11-7-8-12/h3-11H2,1-2H3 |
| InChIKey | ANLMKUQEPXRMGV-UHFFFAOYSA-N |
| SMILES | C(N(CCCC)CCCCl)CCC |
Description and Uses
N-Butyl-N-(3-chloropropyl)butan-1-amine acts as a reagent in the process for the production of dronedarone hydrochloride, an antiarrhythmia drug. Impurity of Butoprozine which is an antiarrhythmic drug.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H372-H317-H334-H350 |
| Precautionary statements | P501-P272-P260-P270-P202-P201-P264-P280-P284-P302+P352-P308+P313-P337+P313-P305+P351+P338-P362+P364-P304+P340-P333+P313-P405 |
| HS Code | 2921199990 |







