BD8062131
1-(5-Bromoquinoxalin-6-yl)thiourea , 97% , 842138-74-3
CAS NO.：842138-74-3
Empirical Formula: C9H7BrN4S
Molecular Weight: 283.15
MDL number: MFCD08445609
EINECS: 688-604-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB214.40 | In Stock |
|
| 250mg | RMB342.40 | In Stock |
|
| 1g | RMB858.40 | In Stock |
|
| 5g | RMB3004.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-202°C |
| Boiling point: | 435.4±55.0 °C(Predicted) |
| Density | 1.835 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly, Heated), DMSO (Sparingly, Heated), Methanol (Very Slightly, Heated) |
| pka | 10.38±0.70(Predicted) |
| form | Solid |
| color | Pale Yellow |
| Major Application | pharmaceutical |
| InChI | 1S/C9H7BrN4S/c10-7-5(14-9(11)15)1-2-6-8(7)13-4-3-12-6/h1-4H,(H3,11,14,15) |
| InChIKey | HURGDIYVXQDVMD-UHFFFAOYSA-N |
| SMILES | S=C(Nc1c(c2nccnc2cc1)Br)N |
Description and Uses
5-Bromoquinazolin-6-ylthiourea is an impurity of the antiglaucoma drug, Brimonidine (B677520).
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P501-P270-P264-P301+P310+P330-P405 |
| WGK Germany | WGK 3 |
| HS Code | 2933997500 |
| Storage Class | 11 - Combustible Solids |
