BD8068331
tert-Butyl N-(2-aminomethylphenyl)carbamate , 97% , 849020-94-6
Synonym(s):
(2-Aminomethyl-phenyl)-carbamic acid tert-butyl ester;tert-Butyl N-(2-aminomethylphenyl)carbamate
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB121.60 | In Stock |
|
| 250mg | RMB182.40 | In Stock |
|
| 1g | RMB458.40 | In Stock |
|
| 5g | RMB1275.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 238-242℃ |
| Density | 1.054g/mLat 25℃ |
| Flash point: | 71°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | liquid |
| pka | 13.67±0.70(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C12H18N2O2/c1-12(2,3)16-11(15)14-10-7-5-4-6-9(10)8-13/h4-7H,8,13H2,1-3H3,(H,14,15) |
| InChIKey | BFFRNSYPZZUZDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CN |
Description and Uses
Reactant for:
- Two-step syntheses of fused quinoxaline-benzodiazepines and bis-benzodiazepines employing a double UDC (Ugi/Deprotect/Cyclize) strategy
- Preparation of hydroquinazoline scaffolds via microwave-promoted Ugi reaction and cyclization
- Preparation of pyrazinone inhibitors of mast cell tryptase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2921490090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |




![tert-Butyl5-amino-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carboxylate](https://img.chemicalbook.com/CAS/GIF/811841-95-9.gif)


