![((3aS,3bR,7aS,8aS)-2,2,5,5-Tetramethyltetrahydro-3aH-[1,3]dioxolo[4',5':4,5]furo[3,2-d][1,3]dioxin-8a-yl)methanol](https://img.chemicalbook.com/CAS/GIF/17682-70-1.gif)
BD8071231
((3aS,3bR,7aS,8aS)-2,2,5,5-Tetramethyltetrahydro-3aH-[1,3]dioxolo[4',5':4,5]furo[3,2-d][1,3]dioxin-8a-yl)methanol , 95+% , 17682-70-1
Synonym(s):
2,3:4,6-Bis-O-(1-methylethylidene)-α-L -sorbofuranose;2,3:4,6-Di-O-isopropylidene-L -sorbose;NSC 23815;Sorbose diacetonide
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2043.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-65°C |
| Boiling point: | 130-135 °C(Press: 0.1-0.3 Torr) |
| Density | 1.181±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone, Dichloromethane |
| pka | 14.66±0.10(Predicted) |
| form | Powder |
| color | White to Off-white |
| optical activity | [α]/D -16.5±1.5°, c = 1.5 in acetone |
| InChI | 1S/C12H20O6/c1-10(2)14-5-7-8(16-10)9-12(6-13,15-7)18-11(3,4)17-9/h7-9,13H,5-6H2,1-4H3/t7-,8+,9-,12-/m0/s1 |
| InChIKey | GQXSDDHYUVYJCQ-NHRVJRKFSA-N |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(CO)OC(C)(C)O[C@H]3[C@@H]2O1 |
| CAS DataBase Reference | 17682-70-1(CAS DataBase Reference) |
Description and Uses
2,3:4,6-Di-O-isopropylidene-α-L-sorbofuranose (cas# 17682-70-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
