BD8077631
Benzoyl-DL-alanine , 98% , 1205-02-3
CAS NO.:1205-02-3
Empirical Formula: C10H11NO3
Molecular Weight: 193.2
MDL number: MFCD00020393
EINECS: 214-879-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25g | RMB115.20 | In Stock |
|
| 100g | RMB316.00 | In Stock |
|
| 500g | RMB1428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167°C |
| Boiling point: | 329.41°C (rough estimate) |
| Density | 1.2307 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.86±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Very slightly soluble in water. |
| BRN | 3201778 |
| InChI | InChI=1S/C10H11NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | UAQVHNZEONHPQG-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](C)NC(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 1205-02-3(CAS DataBase Reference) |
| EPA Substance Registry System | Alanine, N-benzoyl- (1205-02-3) |
Description and Uses
N-Benzoyl-DL-alanine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |




