BD8099231
(S)-Methyl 3-hydroxy-2-(tritylamino)propanoate , 95% , 4465-44-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB55.20 | In Stock |
|
| 5g | RMB139.20 | In Stock |
|
| 10g | RMB252.80 | In Stock |
|
| 25g | RMB515.20 | In Stock |
|
| 100g | RMB1645.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C (lit.) |
| alpha | 31 º (c=1 in methanol) |
| Boiling point: | 538.2±50.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.01±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | [α]20/D +31°, c = 1 in methanol |
| InChI | InChI=1S/C23H23NO3/c1-27-22(26)21(17-25)24-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24-25H,17H2,1H3/t21-/m0/s1 |
| InChIKey | LXAWQKKSNNYYEK-NRFANRHFSA-N |
| SMILES | C(OC)(=O)[C@H](CO)NC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29225090 |
