BD8106931
Fmoc-3-Ala(2-thienyl)-OH , 95% , 130309-35-2
Synonym(s):
(S)-2-(Fmoc-amino)-3-(2-thienyl)propionic acid;Fmoc-3-(2-thienyl)-L -alanine;Fmoc-Thi-OH;N-α-Fmoc-β-thienyl-L-alanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB56.00 | In Stock |
|
| 1g | RMB124.00 | In Stock |
|
| 5g | RMB523.20 | In Stock |
|
| 10g | RMB935.20 | In Stock |
|
| 25g | RMB2284.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218.5 °C |
| Boiling point: | 623.4±55.0 °C(Predicted) |
| Density | 1.2174 (rough estimate) |
| refractive index | 1.5060 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| pka | 3.59±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | InChI=1/C22H19NO4S/c24-21(25)20(12-14-6-5-11-28-14)23-22(26)27-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-11,19-20H,12-13H2,(H,23,26)(H,24,25)/t20-/s3 |
| InChIKey | PXBMQFMUHRNKTG-FQEVSTJZSA-N |
| SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2SC=CC=2)C2=CC=CC=C2C2=CC=CC=C12 |&1:6,r| |
| CAS DataBase Reference | 130309-35-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2934 99 90 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
