BD8142731
Quinocetone , 97% , 81810-66-4
CAS NO.:81810-66-4
Empirical Formula: C18H14N2O3
Molecular Weight: 306.32
MDL number:
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB54.40 | In Stock |
|
| 100g | RMB136.00 | In Stock |
|
| 500g | RMB456.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-188 °C |
| Boiling point: | 576.9±60.0 °C(Predicted) |
| Density | 1.22 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 1.62±0.30(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C18H14N2O3/c1-13-18(17(21)12-11-14-7-3-2-4-8-14)20(23)16-10-6-5-9-15(16)19(13)22/h2-12H,1H3 |
| InChIKey | IOKWXGMNRWVQHX-UHFFFAOYSA-N |
| SMILES | C(C1=C(C)[N+]([O-])=C2C(=[N+]1[O-])C=CC=C2)(=O)C=CC1=CC=CC=C1 |
Description and Uses
Quinocetone is a novel veterinary chemicals that is also bacteriocide and potential anti-tumor agent.
Quinocetone can be used as analyte in analytical study for multi-residue determination of 210 drugs in pork by ultra-high-performance liquid chromatography-tandem mass spectrometry. Bacteriocide and potential anti-tumor agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341-H335 |
| Precautionary statements | P280-P305+P351+P338-P321-P405-P501 |





