BD8165131
(2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate , 95% , 309915-46-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.00 | In Stock |
|
| 1g | RMB64.00 | In Stock |
|
| 5g | RMB231.20 | In Stock |
|
| 10g | RMB449.60 | In Stock |
|
| 25g | RMB1093.60 | In Stock |
|
| 100g | RMB3273.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 280℃ |
| Density | 0.970 |
| Flash point: | 123℃ |
| storage temp. | 2-8°C(protect from light) |
| pka | 8.55±0.60(Predicted) |
| form | solid |
| color | Colourless to light yellow / liquid |
| InChI | InChI=1S/C11H22N2O2/c1-8-7-13(9(2)6-12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | PGZCVLUQTJRRAA-DTWKUNHWSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](C)NC[C@H]1C |
Description and Uses
As an organic intermediate, (2R,5S)-2,5-DiMethyl-piperazine-1-carboxylic acid tert-butyl ester is mainly used in organic synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P301+P312 |
| HS Code | 2933599590 |





