![3,4,5-Trifluoro-4'-[(trans,trans)-4'-pentyl[1,1'-bicyclohexyl]-4-yl]-1,1'-biphenyl](https://img.chemicalbook.com/CAS/GIF/137529-43-2.gif)
BD8185031
3,4,5-Trifluoro-4'-[(trans,trans)-4'-pentyl[1,1'-bicyclohexyl]-4-yl]-1,1'-biphenyl , 97% , 137529-43-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB51.20 | In Stock |
|
| 5g | RMB121.60 | In Stock |
|
| 25g | RMB553.60 | In Stock |
|
| 100g | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90 °C |
| Boiling point: | 510.5±50.0 °C(Predicted) |
| Density | 1.064±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C29H37F3/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-14-16-25(17-15-24)26-18-27(30)29(32)28(31)19-26/h14-23H,2-13H2,1H3/t20-,21-,22-,23? |
| InChIKey | SFGFJCGJXSZYHW-CLMXHQRPSA-N |
| SMILES | C1(C2=CC=C(C3CC[C@H]([C@@H]4CC[C@@H](CCCCC)CC4)CC3)C=C2)=CC(F)=C(F)C(F)=C1 |
| CAS DataBase Reference | 137529-43-2 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2903.99.9001 |
