BD8200831
tert-Butyl 6-amino-3,4-dihydroisoquinoline-2(1H)-carboxylate , 98% , 164148-92-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB63.20 | In Stock |
|
| 250mg | RMB94.40 | In Stock |
|
| 1g | RMB276.00 | In Stock |
|
| 5g | RMB920.00 | In Stock |
|
| 10g | RMB1640.00 | In Stock |
|
| 25g | RMB3516.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 394.7±42.0 °C(Predicted) |
| Density | 1.145±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 4.35±0.20(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-7-6-10-8-12(15)5-4-11(10)9-16/h4-5,8H,6-7,9,15H2,1-3H3 |
| InChIKey | OLOIFCYZWOTWRO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(N)C=C2)CCN1C(OC(C)(C)C)=O |
| CAS DataBase Reference | 164148-92-9(CAS DataBase Reference) |
Description and Uses
6-Amino-2-N-Boc-1,2,3,4-tetrahydroisoquinoline is used as a reagent in the preparation of potent and long acting oral factor Xa inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 36/37/38-50-22 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN2811 |
| HS Code | 2922390090 |
