BD8203831
(1S,2S,3R,4S,5S)-5-Amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetraol , 97% , 83465-22-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB397.60 | In Stock |
|
| 250mg | RMB846.40 | In Stock |
|
| 1g | RMB1568.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148°C |
| Boiling point: | 368.6±42.0 °C(Predicted) |
| Density | 1.623±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated), Water (Sparingly) |
| form | Solid |
| pka | 13.27±0.70(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C7H15NO5/c8-3-1-7(13,2-9)6(12)5(11)4(3)10/h3-6,9-13H,1-2,8H2/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | VDLOJRUTNRJDJO-XUUWZHRGSA-N |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)[C@H](N)C[C@]1(CO)O |
| CAS DataBase Reference | 83465-22-9(CAS DataBase Reference) |
Description and Uses
Valiolamine is a aminocyclitol that exhibits potent alpha-D-glucosidase inhibitory activity against porcine intestinal sucrase, maltase and isomaltase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
