BD8212431
10-Undecenoic Acid Zinc , 98% , 557-08-4
Synonym(s):
10-Undecylenic acid zinc salt;Mycoseptin; Tineafax;Zinc-10-undecenoate
CAS NO.:557-08-4
Empirical Formula: C22H38O4Zn
Molecular Weight: 431.92
MDL number: MFCD00067246
EINECS: 209-155-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB65.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121 °C (lit.) |
| vapor density | 14.9 (vs air) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Practically insoluble in water and in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Specific Gravity | 1.1 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Merck | 13,9916 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | ANTIMICROBIAL ANTICAKING OPACIFYING |
| InChI | InChI=1S/2C11H20O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | YMCOHQVWOBMDCZ-UHFFFAOYSA-L |
| SMILES | O([Zn]OC(=O)CCCCCCCCC=C)C(=O)CCCCCCCCC=C |
| LogP | 3.987 (est) |
| CAS DataBase Reference | 557-08-4(CAS DataBase Reference) |
| EPA Substance Registry System | 10-Undecenoic acid, zinc salt (557-08-4) |
Description and Uses
anthelmintic
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H410-H372 |
| Precautionary statements | P273-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN3077 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






