BD8213931
4-Benzoylbenzonitrile , 95% , 1503-49-7
Synonym(s):
4-Benzoylbenzonitrile
CAS NO.:1503-49-7
Empirical Formula: C14H9NO
Molecular Weight: 207.23
MDL number: MFCD00016382
EINECS: 216-126-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB72.00 | In Stock |
|
| 250mg | RMB113.60 | In Stock |
|
| 1g | RMB329.60 | In Stock |
|
| 5g | RMB1260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-114 °C(lit.) |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1259 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 641181 |
| InChI | InChI=1S/C14H9NO/c15-10-11-6-8-13(9-7-11)14(16)12-4-2-1-3-5-12/h1-9H |
| InChIKey | YSZWJJANSNFQMM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(=O)C2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 1503-49-7(CAS DataBase Reference) |
Description and Uses
Substituted benzophenones?are used to determine the quantum yields for norbornadiene(N)?quadricyclane(Q) and Q?N isomerization. It is employed as a triplet sensitizers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![4-cyano-4''-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]benzophenone](https://img.chemicalbook.com/CAS/GIF/898757-64-7.gif)

