BD8245931
Methyl 5-oxopyrrolidine-3-carboxylate , 97% , 35309-35-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB76.00 | In Stock |
|
| 5g | RMB176.80 | In Stock |
|
| 10g | RMB341.60 | In Stock |
|
| 25g | RMB830.40 | In Stock |
|
| 100g | RMB2563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C |
| Boiling point: | 132-142 °C(Press: 0.45 Torr) |
| Density | 1.204 |
| refractive index | 1.465 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 15.31±0.40(Predicted) |
| color | Pale Beige to Pale Brown |
| InChI | InChI=1S/C6H9NO3/c1-10-6(9)4-2-5(8)7-3-4/h4H,2-3H2,1H3,(H,7,8) |
| InChIKey | FJRTVLWHONLTLA-UHFFFAOYSA-N |
| SMILES | N1C(=O)CC(C(OC)=O)C1 |
Description and Uses
Methyl 5-Oxopyrrolidine-3-carboxylate has been used as a reactant in the synthesis of tert-butyloxycarbonyl protected 4,5-methano-β-proline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
