BD8248831
4,4-Difluorocyclohexanol , 95% , 22419-35-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB86.40 | In Stock |
|
| 250mg | RMB148.00 | In Stock |
|
| 1g | RMB300.00 | In Stock |
|
| 5g | RMB920.00 | In Stock |
|
| 10g | RMB1559.20 | In Stock |
|
| 25g | RMB3197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65°C |
| Boiling point: | 160.6±40.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to lump |
| pka | 14.14±0.40(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H10F2O/c7-6(8)3-1-5(9)2-4-6/h5,9H,1-4H2 |
| InChIKey | XTJZBCBHCPQASK-UHFFFAOYSA-N |
| SMILES | C1(O)CCC(F)(F)CC1 |
| CAS DataBase Reference | 22419-35-8 |
Description and Uses
4,4-Difluorocyclohexanol is a reagent used in the clearance of adenosine inhibitors of bacterial NAD+-dependent DNA ligase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2906120000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







