BD8258031
Ethyl 2-formyl-3-oxopropanoate , 97% , 80370-42-9
CAS NO.：80370-42-9
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD11112084
EINECS: 632-882-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB91.20 | In Stock |
|
| 10g | RMB172.00 | In Stock |
|
| 25g | RMB379.20 | In Stock |
|
| 100g | RMB1421.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 32°C/0.3mmHg(lit.) |
| Density | 1.143±0.06 g/cm3(Predicted) |
| refractive index | 1.4710 to 1.4750 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, Methanol |
| form | Oil |
| pka | 1.55±0.59(Predicted) |
| color | Clear Colorless to Pale Yellow |
| λmax | 245nm(EtOH)(lit.) |
| InChI | InChI=1S/C6H8O4/c1-2-10-6(9)5(3-7)4-8/h3-5H,2H2,1H3 |
| InChIKey | HMFLBGNCDZYITR-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C=O)C=O |
Description and Uses
Propanoicacid,2-formyl-3-oxo-,ethylester is used cyclocondensation reactions for the the preparation of heterocyclic compounds such as polyfunctionally substituted pyridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| HS Code | 2918300090 |
