BD8259031
5-Methoxypyrazine-2-carboxylic acid , 97% , 40155-42-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB139.20 | In Stock |
|
| 25g | RMB631.20 | In Stock |
|
| 100g | RMB2371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197.5-199.5℃ |
| Boiling point: | 296.8±35.0 °C(Predicted) |
| Density | 1.371±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.18±0.10(Predicted) |
| form | Solid |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C6H6N2O3/c1-11-5-3-7-4(2-8-5)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | YVGVOPNUEFTVQO-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(OC)N=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![5-Methoxybenzo[b]thiophene-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/23046-02-8.gif)


