BD8260931
6-Bromo-2-chloroquinoxaline , 98% , 55687-02-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB153.60 | In Stock |
|
| 250mg | RMB230.40 | In Stock |
|
| 1g | RMB572.80 | In Stock |
|
| 5g | RMB2066.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152.5 °C |
| Boiling point: | 312.5±37.0 °C(Predicted) |
| Density | 1.762±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.46±0.30(Predicted) |
| Appearance | Gray to brown Solid |
| InChI | InChI=1S/C8H4BrClN2/c9-5-1-2-6-7(3-5)11-4-8(10)12-6/h1-4H |
| InChIKey | XDJDRCGDVKTDHY-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)N=CC=1Cl |
Description and Uses
6-Bromo-2-chloroquinoxaline is a quinoline derivative that can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
