BD8268731
4-Chloro-2-methylquinazoline , 95% , 6484-24-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.00 | In Stock |
|
| 1g | RMB203.20 | In Stock |
|
| 5g | RMB536.80 | In Stock |
|
| 10g | RMB1036.80 | In Stock |
|
| 25g | RMB2164.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C |
| Boiling point: | 211.2±23.0 °C(Predicted) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 1.28±0.30(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C9H7ClN2/c1-6-11-8-5-3-2-4-7(8)9(10)12-6/h2-5H,1H3 |
| InChIKey | HAAZMOAXEMIBAJ-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC=C2)=C(Cl)N=C1C |
Description and Uses
4-Chloro-2-methylquinazoline is primarily used as a key intermediate in pharmaceutical research and chemical biology studies, particularly in the synthesis of novel drug molecules with biological activities such as anti-tumor and antibacterial effects.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |







