BD8270231
4-Methoxycyclohexanecarboxylic acid , 98% , 95233-12-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB158.40 | In Stock |
|
| 1g | RMB395.20 | In Stock |
|
| 5g | RMB1381.60 | In Stock |
|
| 25g | RMB4428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55.5-58.5 °C |
| Boiling point: | 150-165 °C(Press: 25 Torr) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| pka | 4.68±0.10(Predicted) |
| Appearance | White to off-white <55.5°C Solid,>58.5°C Liquid |
| InChI | InChI=1S/C8H14O3/c1-11-7-4-2-6(3-5-7)8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | WKILSRYNRQGRMA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(OC)CC1 |
Description and Uses
4-Methoxycyclohexanecarboxylic acid is a reagent used in the discovery of a series of highly brain penetrant which are selective muscarinic M1 agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![Ethyl 1,4-dioxaspiro[4.5]decane-8-carboxylate](https://img.chemicalbook.com/CAS/GIF/1489-97-0.gif)
![8-(Boc-amino)-1,4-dioxaspiro[4.5]decane-8-carboxylicAcid](https://img.chemicalbook.com/CAS/GIF/886362-27-2.gif)