BD8276347
Vanillinisobutyrate , 98% , 20665-85-4
CAS NO.:20665-85-4
Empirical Formula: C12H14O4
Molecular Weight: 222.24
MDL number: MFCD00169858
EINECS: 243-956-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25g | RMB108.00 | In Stock |
|
| 100g | RMB354.40 | In Stock |
|
| 500g | RMB1238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27.0 to 31.0 °C |
| Boiling point: | 312.9±27.0 °C(Predicted) |
| Density | 1.12 g/mL at 25 °C (lit.) |
| vapor pressure | 0.017Pa at 20℃ |
| FEMA | 3754 | VANILLIN ISOBUTYRATE |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Odor | at 100.00 %. sweet vanilla creamy fruity caramel chocolate |
| Odor Type | vanilla |
| biological source | synthetic |
| Water Solubility | 573mg/L at 20℃ |
| λmax | 311nm(1-Butanol)(lit.) |
| JECFA Number | 891 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C12H14O4/c1-8(2)12(14)16-10-5-4-9(7-13)6-11(10)15-3/h4-8H,1-3H3 |
| InChIKey | BGKAKRUFBSTALK-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)ccc1OC(=O)C(C)C |
| LogP | 2 |
| CAS DataBase Reference | 20665-85-4(CAS DataBase Reference) |
| EPA Substance Registry System | Vanillin isobutyrate (20665-85-4) |
Description and Uses
Vanillin isobutyrate can be used in the formulation of floral, caramel, and vanilla flavors.







