BD8278731
(R)-Pyrrolidine-3-carboxylic acid , 95% , 72580-54-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB101.60 | In Stock |
|
| 1g | RMB316.00 | In Stock |
|
| 5g | RMB1422.40 | In Stock |
|
| 10g | RMB2751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-191℃ |
| Boiling point: | 252℃ |
| Density | 1.186 |
| Flash point: | 106℃ |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.86±0.20(Predicted) |
| color | White to light yellow |
| optical activity | [α]/D -20.5±1.5°, c = 2 in H2O |
| BRN | 5496144 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-1-2-6-3-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1 |
| InChIKey | JAEIBKXSIXOLOL-SCSAIBSYSA-N |
| SMILES | N1CC[C@@H](C(O)=O)C1 |
| CAS DataBase Reference | 72580-54-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






