BD8291031
(S)-2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)propanamide 2,2,2-trifluoroacetate , 95+% , 96594-10-4
Synonym(s):
L -Alanine 4-methyl-7-coumarinylamide trifluoroacetate salt
CAS NO.：96594-10-4
Empirical Formula: C15H15F3N2O5
Molecular Weight: 360.29
MDL number: MFCD00037394
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-206 °C |
| storage temp. | -20°C |
| solubility | ethanol: 50 mg/mL, clear, colorless |
| form | powder |
| color | White |
| Water Solubility | water: 50mg/mL, clear, colorless to very faintly yellow |
| InChI | 1S/C13H14N2O3.C2HF3O2/c1-7-5-12(16)18-11-6-9(3-4-10(7)11)15-13(17)8(2)14;3-2(4,5)1(6)7/h3-6,8H,14H2,1-2H3,(H,15,17);(H,6,7)/t8-;/m0./s1 |
| InChIKey | YYGKKBUKGNFDJW-QRPNPIFTSA-N |
| SMILES | OC(=O)C(F)(F)F.C[C@H](N)C(=O)Nc1ccc2C(C)=CC(=O)Oc2c1 |
Description and Uses
Fluorogenic peptidase substrate, hydrolysis results in longer wavelength excitation and emission spectrum (?ex 380nm, ?em 440nm).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
