BD8307331
(S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol , 95% , 877397-65-4
CAS NO.:877397-65-4
Empirical Formula: C8H7Cl2FO
Molecular Weight: 209.04
MDL number: MFCD09863793
EINECS: 700-699-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB57.60 | In Stock |
|
| 10g | RMB91.20 | In Stock |
|
| 25g | RMB222.40 | In Stock |
|
| 100g | RMB860.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 261.3±35.0 °C(Predicted) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 13.30±0.20(Predicted) |
| color | White |
| InChI | InChI=1/C8H7Cl2FO/c1-4(12)7-5(9)2-3-6(11)8(7)10/h2-4,12H,1H3/t4-/s3 |
| InChIKey | JAOYKRSASYNDGH-UFLUHPNLNA-N |
| SMILES | [C@H](C1C(=CC=C(F)C=1Cl)Cl)(O)C |&1:0,r| |
| CAS DataBase Reference | 877397-65-4 |
Description and Uses
(S) -1- (2,6-dichloro-3-fluorophenyl) ethanol(C8H7C12FO) is synthesized (R)-3-[l-(2, 6-dichloro-3-fluoro-benzene)- The key intermediate of ethoxy-5- (l-piperidine-4-hydroxy-1 hydrogen-pyrazole-4-hydroxy) -pyrimidine-2-indane. And (R)-3-[l-(2,6-dichloro-3-fluoro-benzene)-ethoxy-5-(l-piperidine-4-hydroxy-1 hydrogen-pyrazole-4-hydroxy) -Pyrimidine-2-indane is a small molecule kinase inhibitor for the treatment of locally advanced or metastatic non-small cell lung cancer (NSCLC) positive for anaplastic lymphohematokinase (ALK).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2906290090 |







