BD8307931
tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate , 95% , 1147557-97-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB35.20 | In Stock |
|
| 250mg | RMB70.40 | In Stock |
|
| 1g | RMB192.80 | In Stock |
|
| 5g | RMB708.00 | In Stock |
|
| 10g | RMB1190.40 | In Stock |
|
| 25g | RMB2347.20 | In Stock |
|
| 100g | RMB7764.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-129℃ |
| Boiling point: | 316.6±42.0 °C(Predicted) |
| Density | 1.17 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.84±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C11H19NO3/c1-10(2,3)15-9(14)12-6-11(7-12)4-8(13)5-11/h8,13H,4-7H2,1-3H3 |
| InChIKey | UMXXHZDEAZUQKZ-UHFFFAOYSA-N |
| SMILES | C1C2(CC(O)C2)CN1C(OC(C)(C)C)=O |
Description and Uses
tert-Butyl 6-Hydroxy-2-azaspiro[3.3]heptane-2-carboxylate is a reactant used in the synthesis of pharmaceuticals such as CNS penetrant CXCR2 antagonists for the potential treatment of CNS demyelinating.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2934999090 |

![tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate](https://img.chemicalbook.com/CAS2/GIF/1147557-97-8.gif)





