![(1S,4S)-2-Oxa-5-azabicyclo[2.2.1]heptane hydrochloride](https://img.chemicalbook.com/CAS/GIF/31560-06-2.gif)
BD8312431
(1S,4S)-2-Oxa-5-azabicyclo[2.2.1]heptane hydrochloride , 97% , 31560-06-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB50.40 | In Stock |
|
| 1g | RMB153.60 | In Stock |
|
| 5g | RMB552.00 | In Stock |
|
| 10g | RMB1065.60 | In Stock |
|
| 25g | RMB2372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| InChI | InChI=1/C5H9NO.ClH/c1-4-3-7-5(1)2-6-4;/h4-6H,1-3H2;1H/t4-,5-;/s3 |
| InChIKey | ZFOKPFPITUUCJX-TXRIQCMBNA-N |
| SMILES | [C@@H]12NC[C@@H](OC1)C2.Cl |&1:0,3,r| |
Description and Uses
2-Oxa-5-azabicyclo[2.2.1]heptane Hydrochloride, can be used in the synthesis of epimeric quaternary derivatives of 2-oxa-5-azabicyclo[2.2.1]heptane acting as medicinal agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2932209090 |
