BD8319231
Boc-D-Phe(4-CN)-OH , 98% , 146727-62-0
Synonym(s):
Boc-4-cyano-D -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB35.20 | In Stock |
|
| 250mg | RMB54.40 | In Stock |
|
| 1g | RMB108.00 | In Stock |
|
| 5g | RMB354.40 | In Stock |
|
| 10g | RMB685.60 | In Stock |
|
| 25g | RMB1567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152.6 °C |
| Boiling point: | 432.4°C (rough estimate) |
| Density | 1.1611 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.73±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 9339089 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | RMBLTLXJGNILPG-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(cc1)C#N)C(O)=O |
| CAS DataBase Reference | 146727-62-0(CAS DataBase Reference) |
Description and Uses
N-Boc-4-cyano-D-phenylalanine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P280h-P301+P312a-P304+P340-P321-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |







